C18H27FN2O — CID 71923294
3-ethyl-9-[3-(4-fluorophenoxy)propyl]-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 71923294) has the molecular formula C18H27FN2O and a molecular weight of 306.42 g/mol. Its IUPAC name is 3-ethyl-9-[3-(4-fluorophenoxy)propyl]-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-ethyl-9-[3-(4-fluorophenoxy)propyl]-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 71923294 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-ethyl-9-[3-(4-fluorophenoxy)propyl]-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CCN1CCC2CCC(C1)N2CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C18H27FN2O/c1-2-20-12-10-16-6-7-17(14-20)21(16)11-3-13-22-18-8-4-15(19)5-9-18/h4-5,8-9,16-17H,2-3,6-7,10-14H2,1H3 |
| InChIKey | WKXLYWANEHVQMQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|