C13H19F3N4O2 — CID 71927132
5-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide (PubChem CID 71927132) has the molecular formula C13H19F3N4O2 and a molecular weight of 320.32 g/mol. Its IUPAC name is 5-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71927132 |
| Molecular Formula | C13H19F3N4O2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 5-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide |
| SMILES | NC(=O)c1cc(C2CCCN(CCOCC(F)(F)F)C2)[nH]n1 |
| InChI | InChI=1S/C13H19F3N4O2/c14-13(15,16)8-22-5-4-20-3-1-2-9(7-20)10-6-11(12(17)21)19-18-10/h6,9H,1-5,7-8H2,(H2,17,21)(H,18,19) |
| InChIKey | NUZIZCRCJKHIGV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|