C18H24N4O2 — CID 96514087
5-[(3R)-1-[2-(2-methylphenoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide (PubChem CID 96514087) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-[(3R)-1-[2-(2-methylphenoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[(3R)-1-[2-(2-methylphenoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 96514087 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 5-[(3R)-1-[2-(2-methylphenoxy)ethyl]piperidin-3-yl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1ccccc1OCCN1CCC[C@@H](c2cc(C(N)=O)n[nH]2)C1 |
| InChI | InChI=1S/C18H24N4O2/c1-13-5-2-3-7-17(13)24-10-9-22-8-4-6-14(12-22)15-11-16(18(19)23)21-20-15/h2-3,5,7,11,14H,4,6,8-10,12H2,1H3,(H2,19,23)(H,20,21)/t14-/m1/s1 |
| InChIKey | KKUAWXYOQNVCIL-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |