C17H22F4N2O — CID 71927424
1-[3-ethyl-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-1-yl]ethanone (PubChem CID 71927424) has the molecular formula C17H22F4N2O and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-[3-ethyl-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-ethyl-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71927424 |
| Molecular Formula | C17H22F4N2O |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[3-ethyl-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-1-yl]ethanone |
| SMILES | CCC1CN(C(C)=O)CCC1NCc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C17H22F4N2O/c1-3-12-10-23(11(2)24)7-6-16(12)22-9-13-8-14(17(19,20)21)4-5-15(13)18/h4-5,8,12,16,22H,3,6-7,9-10H2,1-2H3 |
| InChIKey | RHYKOAFQTFDUDX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |