C18H24N2OS — CID 71927553
1-[4-(1-benzothiophen-3-ylmethylamino)-3-methylpiperidin-1-yl]propan-1-one (PubChem CID 71927553) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-[4-(1-benzothiophen-3-ylmethylamino)-3-methylpiperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-(1-benzothiophen-3-ylmethylamino)-3-methylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71927553 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-[4-(1-benzothiophen-3-ylmethylamino)-3-methylpiperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC(NCc2csc3ccccc23)C(C)C1 |
| InChI | InChI=1S/C18H24N2OS/c1-3-18(21)20-9-8-16(13(2)11-20)19-10-14-12-22-17-7-5-4-6-15(14)17/h4-7,12-13,16,19H,3,8-11H2,1-2H3 |
| InChIKey | HAHCEVPNUPPUID-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |