C18H22N4O3 — CID 71928223
4-[2-(2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl)ethoxy]benzonitrile (PubChem CID 71928223) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[2-(2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl)ethoxy]benzonitrile.
| Compound Name | 4-[2-(2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 71928223 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-[2-(2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl)ethoxy]benzonitrile |
| SMILES | CC(C)N1C(=O)NC2(CCN(CCOc3ccc(C#N)cc3)C2)C1=O |
| InChI | InChI=1S/C18H22N4O3/c1-13(2)22-16(23)18(20-17(22)24)7-8-21(12-18)9-10-25-15-5-3-14(11-19)4-6-15/h3-6,13H,7-10,12H2,1-2H3,(H,20,24) |
| InChIKey | HPVOGWCRDRTEMF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|