C14H20N4O3 — CID 97008299
(5S)-7-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 97008299) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is (5S)-7-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-7-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 97008299 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (5S)-7-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1cnc(CN2CC[C@@]3(C2)NC(=O)N(C(C)C)C3=O)o1 |
| InChI | InChI=1S/C14H20N4O3/c1-9(2)18-12(19)14(16-13(18)20)4-5-17(8-14)7-11-15-6-10(3)21-11/h6,9H,4-5,7-8H2,1-3H3,(H,16,20)/t14-/m0/s1 |
| InChIKey | SOAXKNPFUQJELF-AWEZNQCLSA-N |
| XLogP | 0.89 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|