C19H22N4O2 — CID 97017710
(5S)-3-propan-2-yl-7-(quinolin-2-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 97017710) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (5S)-3-propan-2-yl-7-(quinolin-2-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-3-propan-2-yl-7-(quinolin-2-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 97017710 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (5S)-3-propan-2-yl-7-(quinolin-2-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC(C)N1C(=O)N[C@]2(CCN(Cc3ccc4ccccc4n3)C2)C1=O |
| InChI | InChI=1S/C19H22N4O2/c1-13(2)23-17(24)19(21-18(23)25)9-10-22(12-19)11-15-8-7-14-5-3-4-6-16(14)20-15/h3-8,13H,9-12H2,1-2H3,(H,21,25)/t19-/m0/s1 |
| InChIKey | ITNOIVHXXCVESF-IBGZPJMESA-N |
| XLogP | 2.14 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|