C18H23N3O2 — CID 71930590
3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 71930590) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 71930590 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1CCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H23N3O2/c22-16-18(8-3-4-9-18)19-17(23)21(16)12-11-20-10-7-14-5-1-2-6-15(14)13-20/h1-2,5-6H,3-4,7-13H2,(H,19,23) |
| InChIKey | VWOLKGPFCWSOKG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|