C13H22N2O2S — CID 71931375
N-ethyl-1-ethylsulfonyl-N-(pyridin-2-ylmethyl)propan-2-amine (PubChem CID 71931375) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N-ethyl-1-ethylsulfonyl-N-(pyridin-2-ylmethyl)propan-2-amine.
| Compound Name | N-ethyl-1-ethylsulfonyl-N-(pyridin-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 71931375 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-ethyl-1-ethylsulfonyl-N-(pyridin-2-ylmethyl)propan-2-amine |
| SMILES | CCN(Cc1ccccn1)C(C)CS(=O)(=O)CC |
| InChI | InChI=1S/C13H22N2O2S/c1-4-15(10-13-8-6-7-9-14-13)12(3)11-18(16,17)5-2/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | AVPQXPKWNNRKFF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |