C15H24N2O4S — CID 71934799
N-cyclooctyl-N-methyl-5-(methylsulfamoyl)furan-2-carboxamide (PubChem CID 71934799) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N-cyclooctyl-N-methyl-5-(methylsulfamoyl)furan-2-carboxamide.
| Compound Name | N-cyclooctyl-N-methyl-5-(methylsulfamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 71934799 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-cyclooctyl-N-methyl-5-(methylsulfamoyl)furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N(C)C2CCCCCCC2)o1 |
| InChI | InChI=1S/C15H24N2O4S/c1-16-22(19,20)14-11-10-13(21-14)15(18)17(2)12-8-6-4-3-5-7-9-12/h10-12,16H,3-9H2,1-2H3 |
| InChIKey | DGLBOQJBZCSUAI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |