C20H25N3O2 — CID 71936659
2-(furan-2-yl)-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 71936659) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(furan-2-yl)-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71936659 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-(furan-2-yl)-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)C3CC3c3ccco3)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O2/c1-22-8-10-23(11-9-22)14-15-4-6-16(7-5-15)21-20(24)18-13-17(18)19-3-2-12-25-19/h2-7,12,17-18H,8-11,13-14H2,1H3,(H,21,24) |
| InChIKey | KWSHKNNXUWHHJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |