C17H19N3O2S — CID 71938723
N-(8-methylquinolin-5-yl)-2-oxo-2-(1,4-thiazepan-4-yl)acetamide (PubChem CID 71938723) has the molecular formula C17H19N3O2S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-(8-methylquinolin-5-yl)-2-oxo-2-(1,4-thiazepan-4-yl)acetamide.
| Compound Name | N-(8-methylquinolin-5-yl)-2-oxo-2-(1,4-thiazepan-4-yl)acetamide |
|---|---|
| PubChem CID | 71938723 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-(8-methylquinolin-5-yl)-2-oxo-2-(1,4-thiazepan-4-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N2CCCSCC2)c2cccnc12 |
| InChI | InChI=1S/C17H19N3O2S/c1-12-5-6-14(13-4-2-7-18-15(12)13)19-16(21)17(22)20-8-3-10-23-11-9-20/h2,4-7H,3,8-11H2,1H3,(H,19,21) |
| InChIKey | XVNAQKQPXJHUBT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|