C15H15N5O2 — CID 71940384
1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-(1-methylpyrazol-4-yl)urea (PubChem CID 71940384) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-(1-methylpyrazol-4-yl)urea.
| Compound Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-(1-methylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 71940384 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-(1-methylpyrazol-4-yl)urea |
| SMILES | Cn1cc(NC(=O)Nc2ccc3oc(C4CC4)nc3c2)cn1 |
| InChI | InChI=1S/C15H15N5O2/c1-20-8-11(7-16-20)18-15(21)17-10-4-5-13-12(6-10)19-14(22-13)9-2-3-9/h4-9H,2-3H2,1H3,(H2,17,18,21) |
| InChIKey | MZCZKWRDPAOVEA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |