About 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea
1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea (PubChem CID 86803910) has the molecular formula C17H19N5O3
and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea.
Molecular Properties
| Compound Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea |
| PubChem CID | 86803910 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea |
| SMILES | COCCn1ccc(NC(=O)Nc2ccc3oc(C4CC4)nc3c2)n1 |
| InChI | InChI=1S/C17H19N5O3/c1-24-9-8-22-7-6-15(21-22)20-17(23)18-12-4-5-14-13(10-12)19-16(25-14)11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H2,18,20,21,23) |
| InChIKey | AEVKFHMQICKHKJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
The IUPAC name of 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea (CID 86803910) is 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea.
What is the SMILES notation for 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
The canonical SMILES for 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea is COCCn1ccc(NC(=O)Nc2ccc3oc(C4CC4)nc3c2)n1.
What is the InChIKey of 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
The InChIKey is AEVKFHMQICKHKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O3/c1-24-9-8-22-7-6-15(21-22)20-17(23)18-12-4-5-14-13(10-12)19-16(25-14)11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H2,18,20,21,23).
What are the key properties of 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea has a molecular weight of 341.37 g/mol, XLogP of 3.19, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea is sourced from PubChem (CID 86803910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).