C17H17F2N3OS — CID 71941798
N-[4-(difluoromethylsulfanyl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide (PubChem CID 71941798) has the molecular formula C17H17F2N3OS and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71941798 |
| Molecular Formula | C17H17F2N3OS |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)N1CCCC1c1ccncc1 |
| InChI | InChI=1S/C17H17F2N3OS/c18-16(19)24-14-5-3-13(4-6-14)21-17(23)22-11-1-2-15(22)12-7-9-20-10-8-12/h3-10,15-16H,1-2,11H2,(H,21,23) |
| InChIKey | PJYXCTYKZHXQRL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |