C20H23N3OS2 — CID 71895904
N-[3-(1,3-dithian-2-yl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide (PubChem CID 71895904) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71895904 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(C2SCCCS2)c1)N1CCCC1c1ccncc1 |
| InChI | InChI=1S/C20H23N3OS2/c24-20(23-11-2-6-18(23)15-7-9-21-10-8-15)22-17-5-1-4-16(14-17)19-25-12-3-13-26-19/h1,4-5,7-10,14,18-19H,2-3,6,11-13H2,(H,22,24) |
| InChIKey | BNMJQDHSEWRHTF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |