C22H26N2OS2 — CID 86998562
[4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-4-ylazepan-1-yl)methanone (PubChem CID 86998562) has the molecular formula C22H26N2OS2 and a molecular weight of 398.60 g/mol. Its IUPAC name is [4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-4-ylazepan-1-yl)methanone.
| Compound Name | [4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-4-ylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 86998562 |
| Molecular Formula | C22H26N2OS2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-4-ylazepan-1-yl)methanone |
| SMILES | O=C(c1ccc(C2SCCCS2)cc1)N1CCCCCC1c1ccncc1 |
| InChI | InChI=1S/C22H26N2OS2/c25-21(18-6-8-19(9-7-18)22-26-15-4-16-27-22)24-14-3-1-2-5-20(24)17-10-12-23-13-11-17/h6-13,20,22H,1-5,14-16H2 |
| InChIKey | SHAJTDJIXNBSGF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |