C18H25NOS2 — CID 86979053
[4-(1,3-dithian-2-yl)phenyl]-(2-ethylpiperidin-1-yl)methanone (PubChem CID 86979053) has the molecular formula C18H25NOS2 and a molecular weight of 335.54 g/mol. Its IUPAC name is [4-(1,3-dithian-2-yl)phenyl]-(2-ethylpiperidin-1-yl)methanone.
| Compound Name | [4-(1,3-dithian-2-yl)phenyl]-(2-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 86979053 |
| Molecular Formula | C18H25NOS2 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [4-(1,3-dithian-2-yl)phenyl]-(2-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C18H25NOS2/c1-2-16-6-3-4-11-19(16)17(20)14-7-9-15(10-8-14)18-21-12-5-13-22-18/h7-10,16,18H,2-6,11-13H2,1H3 |
| InChIKey | KQOKXAWZHYFKGB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |