C16H20N2O2S2 — CID 112758779
1-[4-(1,3-dithiolan-2-yl)benzoyl]piperidine-2-carboxamide (PubChem CID 112758779) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[4-(1,3-dithiolan-2-yl)benzoyl]piperidine-2-carboxamide.
| Compound Name | 1-[4-(1,3-dithiolan-2-yl)benzoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 112758779 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[4-(1,3-dithiolan-2-yl)benzoyl]piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1C(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C16H20N2O2S2/c17-14(19)13-3-1-2-8-18(13)15(20)11-4-6-12(7-5-11)16-21-9-10-22-16/h4-7,13,16H,1-3,8-10H2,(H2,17,19) |
| InChIKey | RYDKXIUUDDCRTO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |