C21H22N4OS — CID 87035823
2-pyridin-4-yl-N-[3-(1,3-thiazol-2-yl)phenyl]azepane-1-carboxamide (PubChem CID 87035823) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[3-(1,3-thiazol-2-yl)phenyl]azepane-1-carboxamide.
| Compound Name | 2-pyridin-4-yl-N-[3-(1,3-thiazol-2-yl)phenyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 87035823 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-pyridin-4-yl-N-[3-(1,3-thiazol-2-yl)phenyl]azepane-1-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nccs2)c1)N1CCCCCC1c1ccncc1 |
| InChI | InChI=1S/C21H22N4OS/c26-21(24-18-6-4-5-17(15-18)20-23-12-14-27-20)25-13-3-1-2-7-19(25)16-8-10-22-11-9-16/h4-6,8-12,14-15,19H,1-3,7,13H2,(H,24,26) |
| InChIKey | MVMMPRJJNFHUER-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |