C16H16N4OS — CID 99818294
(2R)-N-(3-cyanophenyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 99818294) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is (2R)-N-(3-cyanophenyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | (2R)-N-(3-cyanophenyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 99818294 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (2R)-N-(3-cyanophenyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)N2CCCC[C@@H]2c2nccs2)c1 |
| InChI | InChI=1S/C16H16N4OS/c17-11-12-4-3-5-13(10-12)19-16(21)20-8-2-1-6-14(20)15-18-7-9-22-15/h3-5,7,9-10,14H,1-2,6,8H2,(H,19,21)/t14-/m1/s1 |
| InChIKey | BSWXRROCSZEUIT-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |