C17H19N5O — CID 126807058
N-(3-cyanophenyl)-2-(pyrazol-1-ylmethyl)piperidine-1-carboxamide (PubChem CID 126807058) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(pyrazol-1-ylmethyl)piperidine-1-carboxamide.
| Compound Name | N-(3-cyanophenyl)-2-(pyrazol-1-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126807058 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-(3-cyanophenyl)-2-(pyrazol-1-ylmethyl)piperidine-1-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)N2CCCCC2Cn2cccn2)c1 |
| InChI | InChI=1S/C17H19N5O/c18-12-14-5-3-6-15(11-14)20-17(23)22-10-2-1-7-16(22)13-21-9-4-8-19-21/h3-6,8-9,11,16H,1-2,7,10,13H2,(H,20,23) |
| InChIKey | CKSXSHVNQDFFLA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |