C19H22N4O2 — CID 95978231
3-[(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]oxybenzonitrile (PubChem CID 95978231) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]oxybenzonitrile.
| Compound Name | 3-[(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 95978231 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-[(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]oxybenzonitrile |
| SMILES | C[C@H](Oc1cccc(C#N)c1)C(=O)N1CCCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C19H22N4O2/c1-15(25-18-8-4-6-16(12-18)13-20)19(24)23-11-3-2-7-17(23)14-22-10-5-9-21-22/h4-6,8-10,12,15,17H,2-3,7,11,14H2,1H3/t15-,17-/m0/s1 |
| InChIKey | ASVILJHTSHTOTI-RDJZCZTQSA-N |
| XLogP | 2.60 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |