C11H19N7 — CID 71943990
N-methyl-1-(1-methylimidazol-2-yl)-N-[(1-propyltetrazol-5-yl)methyl]methanamine (PubChem CID 71943990) has the molecular formula C11H19N7 and a molecular weight of 249.32 g/mol. Its IUPAC name is N-methyl-1-(1-methylimidazol-2-yl)-N-[(1-propyltetrazol-5-yl)methyl]methanamine.
| Compound Name | N-methyl-1-(1-methylimidazol-2-yl)-N-[(1-propyltetrazol-5-yl)methyl]methanamine |
|---|---|
| PubChem CID | 71943990 |
| Molecular Formula | C11H19N7 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-methyl-1-(1-methylimidazol-2-yl)-N-[(1-propyltetrazol-5-yl)methyl]methanamine |
| SMILES | CCCn1nnnc1CN(C)Cc1nccn1C |
| InChI | InChI=1S/C11H19N7/c1-4-6-18-11(13-14-15-18)9-16(2)8-10-12-5-7-17(10)3/h5,7H,4,6,8-9H2,1-3H3 |
| InChIKey | RYISATCJOXBWJH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |