C25H20N6O6 — CID 71945057
4-nitro-N-[[6-[(4-nitrobenzoyl)hydrazinylidene]-3-tricyclo[6.2.1.02,7]undeca-4,9-dienylidene]amino]benzamide (PubChem CID 71945057) has the molecular formula C25H20N6O6 and a molecular weight of 500.47 g/mol. Its IUPAC name is 4-nitro-N-[[6-[(4-nitrobenzoyl)hydrazinylidene]-3-tricyclo[6.2.1.02,7]undeca-4,9-dienylidene]amino]benzamide.
| Compound Name | 4-nitro-N-[[6-[(4-nitrobenzoyl)hydrazinylidene]-3-tricyclo[6.2.1.02,7]undeca-4,9-dienylidene]amino]benzamide |
|---|---|
| PubChem CID | 71945057 |
| Molecular Formula | C25H20N6O6 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 4-nitro-N-[[6-[(4-nitrobenzoyl)hydrazinylidene]-3-tricyclo[6.2.1.02,7]undeca-4,9-dienylidene]amino]benzamide |
| SMILES | O=C(NN=C1C=CC(=NNC(=O)c2ccc([N+](=O)[O-])cc2)C2C3C=CC(C3)C12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H20N6O6/c32-24(14-3-7-18(8-4-14)30(34)35)28-26-20-11-12-21(23-17-2-1-16(13-17)22(20)23)27-29-25(33)15-5-9-19(10-6-15)31(36)37/h1-12,16-17,22-23H,13H2,(H,28,32)(H,29,33) |
| InChIKey | WWCCEFCAVJYMGZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|