C22H18N4 — CID 71945169
2-(4-cyano-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-2-prop-2-enylpropanedinitrile (PubChem CID 71945169) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(4-cyano-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-2-prop-2-enylpropanedinitrile.
| Compound Name | 2-(4-cyano-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-2-prop-2-enylpropanedinitrile |
|---|---|
| PubChem CID | 71945169 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-(4-cyano-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-2-prop-2-enylpropanedinitrile |
| SMILES | C=CCC(C#N)(C#N)c1nc(-c2ccccc2)c2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C22H18N4/c1-2-12-22(14-24,15-25)21-19(13-23)17-10-6-7-11-18(17)20(26-21)16-8-4-3-5-9-16/h2-5,8-9H,1,6-7,10-12H2 |
| InChIKey | QUSINYRPAHZJDC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|