About [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate
[2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate (PubChem CID 71950569) has the molecular formula C15H11Br2NO3
and a molecular weight of 413.07 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate |
| PubChem CID | 71950569 |
| Molecular Formula | C15H11Br2NO3 |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate |
| SMILES | O=C(OCC(=NO)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11Br2NO3/c16-12-5-1-10(2-6-12)14(18-20)9-21-15(19)11-3-7-13(17)8-4-11/h1-8,20H,9H2 |
| InChIKey | LBOZMWBYJSKVAK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate?
The IUPAC name of [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate (CID 71950569) is [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate.
What is the SMILES notation for [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate?
The canonical SMILES for [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate is O=C(OCC(=NO)c1ccc(Br)cc1)c1ccc(Br)cc1.
What is the InChIKey of [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate?
The InChIKey is LBOZMWBYJSKVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Br2NO3/c16-12-5-1-10(2-6-12)14(18-20)9-21-15(19)11-3-7-13(17)8-4-11/h1-8,20H,9H2.
What are the key properties of [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate?
[2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate has a molecular weight of 413.07 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-2-hydroxyiminoethyl] 4-bromobenzoate is sourced from PubChem (CID 71950569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).