C16H11N5O3S — CID 71951949
3-(2-methylfuran-3-yl)-6-[2-(4-nitrophenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 71951949) has the molecular formula C16H11N5O3S and a molecular weight of 353.36 g/mol. Its IUPAC name is 3-(2-methylfuran-3-yl)-6-[2-(4-nitrophenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(2-methylfuran-3-yl)-6-[2-(4-nitrophenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 71951949 |
| Molecular Formula | C16H11N5O3S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-(2-methylfuran-3-yl)-6-[2-(4-nitrophenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1occc1-c1nnc2sc(C=Cc3ccc([N+](=O)[O-])cc3)nn12 |
| InChI | InChI=1S/C16H11N5O3S/c1-10-13(8-9-24-10)15-17-18-16-20(15)19-14(25-16)7-4-11-2-5-12(6-3-11)21(22)23/h2-9H,1H3 |
| InChIKey | MPHFEEIRIAODBL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|