C20H13N5O4S — CID 6196365
(5Z)-2-(2-methylfuran-3-yl)-5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 6196365) has the molecular formula C20H13N5O4S and a molecular weight of 419.42 g/mol. Its IUPAC name is (5Z)-2-(2-methylfuran-3-yl)-5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-2-(2-methylfuran-3-yl)-5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 6196365 |
| Molecular Formula | C20H13N5O4S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (5Z)-2-(2-methylfuran-3-yl)-5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | Cc1occc1-c1nc2s/c(=C\c3cccn3-c3ccc([N+](=O)[O-])cc3)c(=O)n2n1 |
| InChI | InChI=1S/C20H13N5O4S/c1-12-16(8-10-29-12)18-21-20-24(22-18)19(26)17(30-20)11-15-3-2-9-23(15)13-4-6-14(7-5-13)25(27)28/h2-11H,1H3/b17-11- |
| InChIKey | GQRRCWUDOIGZMF-BOPFTXTBSA-N |
| XLogP | 2.97 |
| TPSA | 108.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|