C22H15N5O4S — CID 4709818
5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-2-(phenoxymethyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 4709818) has the molecular formula C22H15N5O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is 5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-2-(phenoxymethyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-2-(phenoxymethyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 4709818 |
| Molecular Formula | C22H15N5O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-2-(phenoxymethyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | O=c1c(=Cc2cccn2-c2ccc([N+](=O)[O-])cc2)sc2nc(COc3ccccc3)nn12 |
| InChI | InChI=1S/C22H15N5O4S/c28-21-19(13-17-5-4-12-25(17)15-8-10-16(11-9-15)27(29)30)32-22-23-20(24-26(21)22)14-31-18-6-2-1-3-7-18/h1-13H,14H2 |
| InChIKey | VHEAXJIXWWTQKI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|