C17H6Cl3FN4O3S — CID 24895571
(5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2-(2,4-dichloro-5-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 24895571) has the molecular formula C17H6Cl3FN4O3S and a molecular weight of 471.68 g/mol. Its IUPAC name is (5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2-(2,4-dichloro-5-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2-(2,4-dichloro-5-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 24895571 |
| Molecular Formula | C17H6Cl3FN4O3S |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 469.92 |
| IUPAC Name | (5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2-(2,4-dichloro-5-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | O=c1/c(=C/c2cc([N+](=O)[O-])ccc2Cl)sc2nc(-c3cc(F)c(Cl)cc3Cl)nn12 |
| InChI | InChI=1S/C17H6Cl3FN4O3S/c18-10-2-1-8(25(27)28)3-7(10)4-14-16(26)24-17(29-14)22-15(23-24)9-5-13(21)12(20)6-11(9)19/h1-6H/b14-4- |
| InChIKey | YQCMGDPIMPJLNR-CPSFFCFKSA-N |
| XLogP | 4.37 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|