C28H18N6O5S — CID 6131696
[2-[(5Z)-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]phenyl] acetate (PubChem CID 6131696) has the molecular formula C28H18N6O5S and a molecular weight of 550.56 g/mol. Its IUPAC name is [2-[(5Z)-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]phenyl] acetate.
| Compound Name | [2-[(5Z)-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 6131696 |
| Molecular Formula | C28H18N6O5S |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | [2-[(5Z)-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1-c1nc2s/c(=C\c3cn(-c4ccccc4)nc3-c3ccc([N+](=O)[O-])cc3)c(=O)n2n1 |
| InChI | InChI=1S/C28H18N6O5S/c1-17(35)39-23-10-6-5-9-22(23)26-29-28-33(31-26)27(36)24(40-28)15-19-16-32(20-7-3-2-4-8-20)30-25(19)18-11-13-21(14-12-18)34(37)38/h2-16H,1H3/b24-15- |
| InChIKey | RSDCGFCBHGPDSR-IWIPYMOSSA-N |
| XLogP | 4.05 |
| TPSA | 134.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|