C17H6Cl4FN3OS — CID 74347765
2-(2,4-dichloro-5-fluorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 74347765) has the molecular formula C17H6Cl4FN3OS and a molecular weight of 461.13 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 74347765 |
| Molecular Formula | C17H6Cl4FN3OS |
| Molecular Weight | 461.13 g/mol |
| Exact Mass | 458.90 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | O=c1c(=Cc2ccc(Cl)cc2Cl)sc2nc(-c3cc(F)c(Cl)cc3Cl)nn12 |
| InChI | InChI=1S/C17H6Cl4FN3OS/c18-8-2-1-7(10(19)4-8)3-14-16(26)25-17(27-14)23-15(24-25)9-5-13(22)12(21)6-11(9)20/h1-6H |
| InChIKey | VCXXMCAJBUGXGU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.13 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|