C21H23N5O3 — CID 71960490
3-(3,4-dimethoxyphenyl)-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]prop-2-enamide (PubChem CID 71960490) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 71960490 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCCNc2ccc(-n3cccc3)nn2)cc1OC |
| InChI | InChI=1S/C21H23N5O3/c1-28-17-7-5-16(15-18(17)29-2)6-10-21(27)23-12-11-22-19-8-9-20(25-24-19)26-13-3-4-14-26/h3-10,13-15H,11-12H2,1-2H3,(H,22,24)(H,23,27) |
| InChIKey | DYIIFIFJUSBIKI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|