C19H15N3O6S — CID 71962003
3-(1,3-benzodioxol-5-yl)-N-[5-(2-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide (PubChem CID 71962003) has the molecular formula C19H15N3O6S and a molecular weight of 413.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[5-(2-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[5-(2-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71962003 |
| Molecular Formula | C19H15N3O6S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[5-(2-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccccc1-c1nnc(NC(=O)C=Cc2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C19H15N3O6S/c1-29(24,25)16-5-3-2-4-13(16)18-21-22-19(28-18)20-17(23)9-7-12-6-8-14-15(10-12)27-11-26-14/h2-10H,11H2,1H3,(H,20,22,23) |
| InChIKey | KJPDBTITFWQTAC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|