C16H10BrN3O4S — CID 71961454
3-(1,3-benzodioxol-5-yl)-N-[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide (PubChem CID 71961454) has the molecular formula C16H10BrN3O4S and a molecular weight of 420.24 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71961454 |
| Molecular Formula | C16H10BrN3O4S |
| Molecular Weight | 420.24 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)Nc1nnc(-c2ccc(Br)s2)o1 |
| InChI | InChI=1S/C16H10BrN3O4S/c17-13-5-4-12(25-13)15-19-20-16(24-15)18-14(21)6-2-9-1-3-10-11(7-9)23-8-22-10/h1-7H,8H2,(H,18,20,21) |
| InChIKey | OBVQZIOIZYSUMH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|