C29H33NO7 — CID 71966371
1-[(6S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenoxy-4-(2-phenylethenyl)azetidin-2-one (PubChem CID 71966371) has the molecular formula C29H33NO7 and a molecular weight of 507.58 g/mol. Its IUPAC name is 1-[(6S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenoxy-4-(2-phenylethenyl)azetidin-2-one.
| Compound Name | 1-[(6S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenoxy-4-(2-phenylethenyl)azetidin-2-one |
|---|---|
| PubChem CID | 71966371 |
| Molecular Formula | C29H33NO7 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 1-[(6S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenoxy-4-(2-phenylethenyl)azetidin-2-one |
| SMILES | CC1(C)OCC(C2OC3OC(C)(C)OC3[C@H]2N2C(=O)C(Oc3ccccc3)C2C=Cc2ccccc2)O1 |
| InChI | InChI=1S/C29H33NO7/c1-28(2)32-17-21(35-28)24-22(25-27(34-24)37-29(3,4)36-25)30-20(16-15-18-11-7-5-8-12-18)23(26(30)31)33-19-13-9-6-10-14-19/h5-16,20-25,27H,17H2,1-4H3/t20?,21?,22-,23?,24?,25?,27?/m0/s1 |
| InChIKey | SIJCESLFPDXFCO-HUMWTZHYSA-N |
| XLogP | 3.75 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |