C23H30N2O8 — CID 51722239
(E)-N'-[2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetyl]-3-phenylprop-2-enehydrazide (PubChem CID 51722239) has the molecular formula C23H30N2O8 and a molecular weight of 462.50 g/mol. Its IUPAC name is (E)-N'-[2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetyl]-3-phenylprop-2-enehydrazide.
| Compound Name | (E)-N'-[2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetyl]-3-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 51722239 |
| Molecular Formula | C23H30N2O8 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (E)-N'-[2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetyl]-3-phenylprop-2-enehydrazide |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OCC(=O)NNC(=O)/C=C/c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C23H30N2O8/c1-22(2)29-12-15(31-22)18-19(20-21(30-18)33-23(3,4)32-20)28-13-17(27)25-24-16(26)11-10-14-8-6-5-7-9-14/h5-11,15,18-21H,12-13H2,1-4H3,(H,24,26)(H,25,27)/b11-10+/t15-,18-,19+,20-,21-/m1/s1 |
| InChIKey | RHUOIDQSBWTIEJ-VKWROLEUSA-N |
| XLogP | 1.26 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|