C15H16N4O3S — CID 71967386
1,5-dimethyl-N-(1-methylindol-3-yl)sulfonylpyrazole-4-carboxamide (PubChem CID 71967386) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 1,5-dimethyl-N-(1-methylindol-3-yl)sulfonylpyrazole-4-carboxamide.
| Compound Name | 1,5-dimethyl-N-(1-methylindol-3-yl)sulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71967386 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1,5-dimethyl-N-(1-methylindol-3-yl)sulfonylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NS(=O)(=O)c2cn(C)c3ccccc23)cnn1C |
| InChI | InChI=1S/C15H16N4O3S/c1-10-12(8-16-19(10)3)15(20)17-23(21,22)14-9-18(2)13-7-5-4-6-11(13)14/h4-9H,1-3H3,(H,17,20) |
| InChIKey | RMYJSOIDMMRBFI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |