C16H20ClN5O2 — CID 71969302
N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-(1H-imidazol-2-yl)piperidine-1-carboxamide (PubChem CID 71969302) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-(1H-imidazol-2-yl)piperidine-1-carboxamide.
| Compound Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-(1H-imidazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71969302 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-(1H-imidazol-2-yl)piperidine-1-carboxamide |
| SMILES | O=C(NCCOc1ncccc1Cl)N1CCCCC1c1ncc[nH]1 |
| InChI | InChI=1S/C16H20ClN5O2/c17-12-4-3-6-20-15(12)24-11-9-21-16(23)22-10-2-1-5-13(22)14-18-7-8-19-14/h3-4,6-8,13H,1-2,5,9-11H2,(H,18,19)(H,21,23) |
| InChIKey | DGRYGFROEQXKPZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|