C14H21ClN4O2 — CID 75381167
N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-4-ethylpiperazine-1-carboxamide (PubChem CID 75381167) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-4-ethylpiperazine-1-carboxamide.
| Compound Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-4-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 75381167 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-4-ethylpiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NCCOc2ncccc2Cl)CC1 |
| InChI | InChI=1S/C14H21ClN4O2/c1-2-18-7-9-19(10-8-18)14(20)17-6-11-21-13-12(15)4-3-5-16-13/h3-5H,2,6-11H2,1H3,(H,17,20) |
| InChIKey | SMIXCZHQLJEGNN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|