C16H19FN4O2 — CID 71969911
N-(2-fluorophenyl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine-4-carboxamide (PubChem CID 71969911) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 71969911 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-(2-fluorophenyl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine-4-carboxamide |
| SMILES | Cn1cc(C2(C)CN(C(=O)Nc3ccccc3F)CCO2)cn1 |
| InChI | InChI=1S/C16H19FN4O2/c1-16(12-9-18-20(2)10-12)11-21(7-8-23-16)15(22)19-14-6-4-3-5-13(14)17/h3-6,9-10H,7-8,11H2,1-2H3,(H,19,22) |
| InChIKey | XXTCVCUHPMLWNP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |