C14H12FN3O5 — CID 71969986
5-acetyl-1-[(2-fluoro-4-nitrophenyl)methyl]-3-methylpyrimidine-2,4-dione (PubChem CID 71969986) has the molecular formula C14H12FN3O5 and a molecular weight of 321.26 g/mol. Its IUPAC name is 5-acetyl-1-[(2-fluoro-4-nitrophenyl)methyl]-3-methylpyrimidine-2,4-dione.
| Compound Name | 5-acetyl-1-[(2-fluoro-4-nitrophenyl)methyl]-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71969986 |
| Molecular Formula | C14H12FN3O5 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-acetyl-1-[(2-fluoro-4-nitrophenyl)methyl]-3-methylpyrimidine-2,4-dione |
| SMILES | CC(=O)c1cn(Cc2ccc([N+](=O)[O-])cc2F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H12FN3O5/c1-8(19)11-7-17(14(21)16(2)13(11)20)6-9-3-4-10(18(22)23)5-12(9)15/h3-5,7H,6H2,1-2H3 |
| InChIKey | STAXMUVEVOSJQC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 104.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|