C15H26N4OS — CID 71971414
1-(3-ethylsulfanylcyclopentyl)-3-(1-imidazol-1-ylpropan-2-yl)-1-methylurea (PubChem CID 71971414) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-(3-ethylsulfanylcyclopentyl)-3-(1-imidazol-1-ylpropan-2-yl)-1-methylurea.
| Compound Name | 1-(3-ethylsulfanylcyclopentyl)-3-(1-imidazol-1-ylpropan-2-yl)-1-methylurea |
|---|---|
| PubChem CID | 71971414 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-(3-ethylsulfanylcyclopentyl)-3-(1-imidazol-1-ylpropan-2-yl)-1-methylurea |
| SMILES | CCSC1CCC(N(C)C(=O)NC(C)Cn2ccnc2)C1 |
| InChI | InChI=1S/C15H26N4OS/c1-4-21-14-6-5-13(9-14)18(3)15(20)17-12(2)10-19-8-7-16-11-19/h7-8,11-14H,4-6,9-10H2,1-3H3,(H,17,20) |
| InChIKey | YWMIZINGJUGEEI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |