C12H9N5O2S — CID 71971846
2-(5-methyl-2-nitrophenyl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 71971846) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-(5-methyl-2-nitrophenyl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-(5-methyl-2-nitrophenyl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 71971846 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-(5-methyl-2-nitrophenyl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccc([N+](=O)[O-])c(Sc2nc3ncccn3n2)c1 |
| InChI | InChI=1S/C12H9N5O2S/c1-8-3-4-9(17(18)19)10(7-8)20-12-14-11-13-5-2-6-16(11)15-12/h2-7H,1H3 |
| InChIKey | FCEGXQLMOYFFIU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|