C14H16FN3OS — CID 71972398
N-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 71972398) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71972398 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | CSCc1cc(F)ccc1CNC(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C14H16FN3OS/c1-18-8-12(7-17-18)14(19)16-6-10-3-4-13(15)5-11(10)9-20-2/h3-5,7-8H,6,9H2,1-2H3,(H,16,19) |
| InChIKey | FWXQDPQMFUWNMG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |