C17H29N3O2S — CID 71972719
3-(5-hydroxy-4,4-dimethylpentyl)-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea (PubChem CID 71972719) has the molecular formula C17H29N3O2S and a molecular weight of 339.51 g/mol. Its IUPAC name is 3-(5-hydroxy-4,4-dimethylpentyl)-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea.
| Compound Name | 3-(5-hydroxy-4,4-dimethylpentyl)-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea |
|---|---|
| PubChem CID | 71972719 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 3-(5-hydroxy-4,4-dimethylpentyl)-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea |
| SMILES | Cc1nc2c(s1)C(N(C)C(=O)NCCCC(C)(C)CO)CCC2 |
| InChI | InChI=1S/C17H29N3O2S/c1-12-19-13-7-5-8-14(15(13)23-12)20(4)16(22)18-10-6-9-17(2,3)11-21/h14,21H,5-11H2,1-4H3,(H,18,22) |
| InChIKey | SZFUBEDZQXUXDT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|