C11H19N3O — CID 71974204
3,5-diethyl-1-(oxolan-3-ylmethyl)-1,2,4-triazole (PubChem CID 71974204) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,5-diethyl-1-(oxolan-3-ylmethyl)-1,2,4-triazole.
| Compound Name | 3,5-diethyl-1-(oxolan-3-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 71974204 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 3,5-diethyl-1-(oxolan-3-ylmethyl)-1,2,4-triazole |
| SMILES | CCc1nc(CC)n(CC2CCOC2)n1 |
| InChI | InChI=1S/C11H19N3O/c1-3-10-12-11(4-2)14(13-10)7-9-5-6-15-8-9/h9H,3-8H2,1-2H3 |
| InChIKey | OASSNPNXQLGISW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |