C16H18N2O2S — CID 71975257
3-(2,2-dimethylthiomorpholine-4-carbonyl)-1H-quinolin-4-one (PubChem CID 71975257) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-(2,2-dimethylthiomorpholine-4-carbonyl)-1H-quinolin-4-one.
| Compound Name | 3-(2,2-dimethylthiomorpholine-4-carbonyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 71975257 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-(2,2-dimethylthiomorpholine-4-carbonyl)-1H-quinolin-4-one |
| SMILES | CC1(C)CN(C(=O)c2c[nH]c3ccccc3c2=O)CCS1 |
| InChI | InChI=1S/C16H18N2O2S/c1-16(2)10-18(7-8-21-16)15(20)12-9-17-13-6-4-3-5-11(13)14(12)19/h3-6,9H,7-8,10H2,1-2H3,(H,17,19) |
| InChIKey | XSPUXLPWEHSRQC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |